P450 protein:
| P450 Symbol | CYP92B14 |
| Protein name | Sesamolin synthase |
| Uniprot ID | A0A2Z5U627 |
| Gene ID | 105175169 |
| Species | Sesamum indicum (Oriental sesame) (Sesamum orientale) |
| Txid | 4182 |
| P450 protein structure | AlphaFold |
| Subcellular location | Membrane; Single-pass type II membrane protein |
| Protein Sequence |
Reaction:
| Reaction type | Oxidation |
| Reaction site | CH of aromatic ring |
(+)-Sesamin CYP92B14
(+)-Sesaminol |
Substrate Information:
| Substrate Name | (+)-Sesamin |
| Substrate Chemical Formula | C20H18O6 |
| Substrate PubChem CID | 72307 |
| Substrate PubChem SID | / |
| Substrate Smiles | C1[C@H]2[C@H](CO[C@@H]2C3=CC4=C(C=C3)OCO4)[C@H](O1)C5=CC6=C(C=C5)OCO6 |
| Substrate Structure |
|
|---|
Product Information:
| Product Name | (+)-Sesaminol |
| Product Chemical Formula | C20H18O7 |
| Product PubChem CID | 94672 |
| Product PubChem SID | / |
| Product Smiles | C1[C@H]2[C@H](CO[C@@H]2C3=CC4=C(C=C3O)OCO4)[C@H](O1)C5=CC6=C(C=C5)OCO6 |
| Product Structure |
|
|---|
References:
| Title: | Oxidative rearrangement of (+)-sesamin by CYP92B14 co-generates twin dietary lignans in sesame. |
| PMID: | 29255253 |
| Journal: | Nature communications |
| Year: | 2017/12/18 |