Detail Information
P450 protein:
| P450 Symbol | CYP1A1 |
| Protein name | Cytochrome P450 1A1 |
| Uniprot ID | P04798 |
| Gene ID | 1543 |
| Species | Homo sapiens (Human) |
| Txid | 9606 |
| P450 protein structure | AlphaFold ; PDBe |
| Subcellular location | Endoplasmic reticulum membrane; Peripheral membrane protein Mitochondrion inner membrane; Peripheral membrane protein Microsome membrane; Peripheral membrane protein Cytoplasm |
| Protein Sequence |
Reaction:
| Reaction type | Oxidation |
| Reaction site | CH of aromatic ring |
Estrone CYP1A1 
4-Hydroxyestrone |
Substrate Information:
| Substrate Name | Estrone |
| Substrate Chemical Formula | C18H22O2 |
| Substrate PubChem CID | 5870 |
| Substrate PubChem SID | / |
| Substrate Smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)O |
| Substrate Structure |
|
|---|
Product Information:
| Product Name | 4-Hydroxyestrone |
| Product Chemical Formula | C18H22O3 |
| Product PubChem CID | 9971251 |
| Product PubChem SID | / |
| Product Smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4O)O |
| Product Structure |
|
|---|
References:
| Title: | Characterization of the oxidative metabolites of 17beta-estradiol and estrone formed by 15 selectively expressed human cytochrome p450 isoforms. |
| PMID: | 12865317 |
| Journal: | Endocrinology |
| Year: | 2003-08-01 |
| Title: | Association of CYP1A1 polymorphisms with differential metabolic activation of 17beta-estradiol and estrone. |
| PMID: | 15805301 |
| Journal: | Cancer research |
| Year: | 2005-04-01 |